About 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine
3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine (PubChem CID 104059477) has the molecular formula C11H18FNO
and a molecular weight of 199.26 g/mol. Its IUPAC name is 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine.
Molecular Properties
| Compound Name | 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine |
| PubChem CID | 104059477 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine |
| SMILES | C1CC(CNC1)C(C2=COCCC2)F |
| InChI | InChI=1S/C11H18FNO/c12-11(9-3-1-5-13-7-9)10-4-2-6-14-8-10/h8-9,11,13H,1-7H2 |
| InChIKey | VWUMVVJALMLYAS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 21.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 217 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine?
The IUPAC name of 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine (CID 104059477) is 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine.
What is the SMILES notation for 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine?
The canonical SMILES for 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine is C1CC(CNC1)C(C2=COCCC2)F.
What is the InChIKey of 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine?
The InChIKey is VWUMVVJALMLYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FNO/c12-11(9-3-1-5-13-7-9)10-4-2-6-14-8-10/h8-9,11,13H,1-7H2.
What are the key properties of 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine?
3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine has a molecular weight of 199.26 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-dihydro-2H-pyran-5-yl(fluoro)methyl]piperidine is sourced from PubChem (CID 104059477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).