C20H20N2O4S — CID 1040629
3-(2-tert-butylsulfonylphenyl)-5-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 1040629) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-(2-tert-butylsulfonylphenyl)-5-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-tert-butylsulfonylphenyl)-5-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 1040629 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-(2-tert-butylsulfonylphenyl)-5-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)c1ccccc1-c1noc(-c2ccccc2)c1C(N)=O |
| InChI | InChI=1S/C20H20N2O4S/c1-20(2,3)27(24,25)15-12-8-7-11-14(15)17-16(19(21)23)18(26-22-17)13-9-5-4-6-10-13/h4-12H,1-3H3,(H2,21,23) |
| InChIKey | ZRIJBIWHFQAXID-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |