C17H31NO5S — CID 10406307
tert-butyl (4S)-5-acetylsulfanyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate (PubChem CID 10406307) has the molecular formula C17H31NO5S and a molecular weight of 361.50 g/mol. Its IUPAC name is tert-butyl (4S)-5-acetylsulfanyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate.
| Compound Name | tert-butyl (4S)-5-acetylsulfanyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 10406307 |
| Molecular Formula | C17H31NO5S |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl (4S)-5-acetylsulfanyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoate |
| SMILES | CC(=O)SC[C@H](CCC(=O)OC(C)(C)C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO5S/c1-12(19)24-11-13(9-10-14(20)22-16(2,3)4)18(8)15(21)23-17(5,6)7/h13H,9-11H2,1-8H3/t13-/m0/s1 |
| InChIKey | ZPYCTGSNOXQDFX-ZDUSSCGKSA-N |
| XLogP | 3.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|