C21H14O6 — CID 10406329
1,8-dihydroxy-10-[(3,4,5-trihydroxyphenyl)methylidene]anthracen-9-one (PubChem CID 10406329) has the molecular formula C21H14O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is 1,8-dihydroxy-10-[(3,4,5-trihydroxyphenyl)methylidene]anthracen-9-one.
| Compound Name | 1,8-dihydroxy-10-[(3,4,5-trihydroxyphenyl)methylidene]anthracen-9-one |
|---|---|
| PubChem CID | 10406329 |
| Molecular Formula | C21H14O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1,8-dihydroxy-10-[(3,4,5-trihydroxyphenyl)methylidene]anthracen-9-one |
| SMILES | O=C1c2c(O)cccc2C(=Cc2cc(O)c(O)c(O)c2)c2cccc(O)c21 |
| InChI | InChI=1S/C21H14O6/c22-14-5-1-3-11-13(7-10-8-16(24)20(26)17(25)9-10)12-4-2-6-15(23)19(12)21(27)18(11)14/h1-9,22-26H |
| InChIKey | MCYXTPNILAVSKG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|