About 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine
1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine (PubChem CID 10406366) has the molecular formula C24H30N2O
and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine.
Molecular Properties
| Compound Name | 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine |
| PubChem CID | 10406366 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine |
| SMILES | COc1ccc2c(c1)C(CCCN1CCN(c3ccccc3)CC1)=CCC2 |
| InChI | InChI=1S/C24H30N2O/c1-27-23-13-12-21-8-5-7-20(24(21)19-23)9-6-14-25-15-17-26(18-16-25)22-10-3-2-4-11-22/h2-4,7,10-13,19H,5-6,8-9,14-18H2,1H3 |
| InChIKey | GFPSKAXAVWQUOE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine?
The IUPAC name of 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine (CID 10406366) is 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine.
What is the SMILES notation for 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine?
The canonical SMILES for 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine is COc1ccc2c(c1)C(CCCN1CCN(c3ccccc3)CC1)=CCC2.
What is the InChIKey of 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine?
The InChIKey is GFPSKAXAVWQUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O/c1-27-23-13-12-21-8-5-7-20(24(21)19-23)9-6-14-25-15-17-26(18-16-25)22-10-3-2-4-11-22/h2-4,7,10-13,19H,5-6,8-9,14-18H2,1H3.
What are the key properties of 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine?
1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine has a molecular weight of 362.52 g/mol, XLogP of 4.63, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(7-methoxy-3,4-dihydronaphthalen-1-yl)propyl]-4-phenylpiperazine is sourced from PubChem (CID 10406366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).