C23H25NO3 — CID 10406413
10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-ol (PubChem CID 10406413) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-ol.
| Compound Name | 10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 10406413 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-ol |
| SMILES | C=CCC1Oc2ccc(O)c(OC)c2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C23H25NO3/c1-6-7-17-20-14(21-18(27-17)11-10-16(25)22(21)26-5)8-9-15-19(20)13(2)12-23(3,4)24-15/h6,8-12,17,24-25H,1,7H2,2-5H3 |
| InChIKey | FOSHWESRGNRMBT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|