C17H10F4N2O3 — CID 10406564
ethyl 1-(2,4-difluorophenyl)-6,7-difluoro-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 10406564) has the molecular formula C17H10F4N2O3 and a molecular weight of 366.27 g/mol. Its IUPAC name is ethyl 1-(2,4-difluorophenyl)-6,7-difluoro-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1-(2,4-difluorophenyl)-6,7-difluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 10406564 |
| Molecular Formula | C17H10F4N2O3 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | ethyl 1-(2,4-difluorophenyl)-6,7-difluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(F)cc2F)c2nc(F)c(F)cc2c1=O |
| InChI | InChI=1S/C17H10F4N2O3/c1-2-26-17(25)10-7-23(13-4-3-8(18)5-11(13)19)16-9(14(10)24)6-12(20)15(21)22-16/h3-7H,2H2,1H3 |
| InChIKey | QAECISMGQFEKGU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|