C22H26N2OS — CID 10406614
8-[propyl(2-thiophen-2-ylethyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde (PubChem CID 10406614) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is 8-[propyl(2-thiophen-2-ylethyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde.
| Compound Name | 8-[propyl(2-thiophen-2-ylethyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
|---|---|
| PubChem CID | 10406614 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 8-[propyl(2-thiophen-2-ylethyl)amino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
| SMILES | CCCN(CCc1cccs1)C1CCc2ccc3[nH]cc(C=O)c3c2C1 |
| InChI | InChI=1S/C22H26N2OS/c1-2-10-24(11-9-19-4-3-12-26-19)18-7-5-16-6-8-21-22(20(16)13-18)17(15-25)14-23-21/h3-4,6,8,12,14-15,18,23H,2,5,7,9-11,13H2,1H3 |
| InChIKey | NATZFOMSDOBVCC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|