About 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline
5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline (PubChem CID 10406636) has the molecular formula C20H12F3N3O
and a molecular weight of 367.30 g/mol. Its IUPAC name is 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]oxyisoquinoline.
Molecular Properties
| Compound Name | 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline |
| PubChem CID | 10406636 |
| Molecular Formula | C20H12F3N3O |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]oxyisoquinoline |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)OC3=NC=NC(=C3)C4=CC=C(C=C4)C(F)(F)F |
| InChI | InChI=1S/C20H12F3N3O/c21-20(22,23)15-6-4-13(5-7-15)17-10-19(26-12-25-17)27-18-3-1-2-14-11-24-9-8-16(14)18/h1-12H |
| InChIKey | HIUCBKNFZVMJTK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | 482 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline?
The IUPAC name of 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline (CID 10406636) is 5-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]oxyisoquinoline.
What is the SMILES notation for 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline?
The canonical SMILES for 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline is C1=CC2=C(C=CN=C2)C(=C1)OC3=NC=NC(=C3)C4=CC=C(C=C4)C(F)(F)F.
What is the InChIKey of 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline?
The InChIKey is HIUCBKNFZVMJTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12F3N3O/c21-20(22,23)15-6-4-13(5-7-15)17-10-19(26-12-25-17)27-18-3-1-2-14-11-24-9-8-16(14)18/h1-12H.
What are the key properties of 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline?
5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline has a molecular weight of 367.30 g/mol, XLogP of 4.80, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-({6-[4-(Trifluoromethyl)phenyl]pyrimidin-4-yl}oxy)isoquinoline is sourced from PubChem (CID 10406636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).