About 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride
5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride (PubChem CID 10406759) has the molecular formula C21H21ClN2O2
and a molecular weight of 368.86 g/mol. Its IUPAC name is 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride.
Molecular Properties
| Compound Name | 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride |
| PubChem CID | 10406759 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride |
| SMILES | C[n+]1cccn1CC1CC(c2ccccc2)(c2ccccc2)C(=O)O1.[Cl-] |
| InChI | InChI=1S/C21H21N2O2.ClH/c1-22-13-8-14-23(22)16-19-15-21(20(24)25-19,17-9-4-2-5-10-17)18-11-6-3-7-12-18;/h2-14,19H,15-16H2,1H3;1H/q+1;/p-1 |
| InChIKey | HHPZPKYWDYUSNZ-UHFFFAOYSA-M |
| XLogP | -0.38 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The IUPAC name of 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride (CID 10406759) is 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride.
What is the SMILES notation for 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The canonical SMILES for 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride is C[n+]1cccn1CC1CC(c2ccccc2)(c2ccccc2)C(=O)O1.[Cl-].
What is the InChIKey of 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The InChIKey is HHPZPKYWDYUSNZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H21N2O2.ClH/c1-22-13-8-14-23(22)16-19-15-21(20(24)25-19,17-9-4-2-5-10-17)18-11-6-3-7-12-18;/h2-14,19H,15-16H2,1H3;1H/q+1;/p-1.
What are the key properties of 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride has a molecular weight of 368.86 g/mol, XLogP of -0.38, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methylpyrazol-2-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride is sourced from PubChem (CID 10406759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).