C24H25F3O3 — CID 1040690
3,3,6,6-tetramethyl-9-[2-(trifluoromethyl)phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 1040690) has the molecular formula C24H25F3O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-[2-(trifluoromethyl)phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-[2-(trifluoromethyl)phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1040690 |
| Molecular Formula | C24H25F3O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-[2-(trifluoromethyl)phenyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H25F3O3/c1-22(2)9-15(28)20-17(11-22)30-18-12-23(3,4)10-16(29)21(18)19(20)13-7-5-6-8-14(13)24(25,26)27/h5-8,19H,9-12H2,1-4H3 |
| InChIKey | PTUHUWLCQONBIG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |