C21H28O4S — CID 10407204
(1S,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-10-phenylsulfanyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10407204) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is (1S,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-10-phenylsulfanyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-10-phenylsulfanyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10407204 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (1S,4S,5R,8S,9R,10S,12S,13R)-1,5,9-trimethyl-10-phenylsulfanyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@H]1[C@H](Sc2ccccc2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C21H28O4S/c1-13-9-10-17-14(2)18(26-15-7-5-4-6-8-15)22-19-21(17)16(13)11-12-20(3,23-19)24-25-21/h4-8,13-14,16-19H,9-12H2,1-3H3/t13-,14-,16+,17+,18+,19-,20+,21-/m1/s1 |
| InChIKey | KGTASLZVWISSEZ-UIDINZOYSA-N |
| XLogP | 4.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|