C20H22Cl2N2O — CID 10407222
5-[2-(3,4-dichlorophenyl)ethylamino]-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 10407222) has the molecular formula C20H22Cl2N2O and a molecular weight of 377.32 g/mol. Its IUPAC name is 5-[2-(3,4-dichlorophenyl)ethylamino]-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 5-[2-(3,4-dichlorophenyl)ethylamino]-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 10407222 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 5-[2-(3,4-dichlorophenyl)ethylamino]-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | C=CCn1c2c(ccc1=O)C(NCCc1ccc(Cl)c(Cl)c1)CCC2 |
| InChI | InChI=1S/C20H22Cl2N2O/c1-2-12-24-19-5-3-4-18(15(19)7-9-20(24)25)23-11-10-14-6-8-16(21)17(22)13-14/h2,6-9,13,18,23H,1,3-5,10-12H2 |
| InChIKey | MRYNXLDJVQYENB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|