C24H27NO3 — CID 10407251
2,2-dimethyl-6-[4-(4-methylphenyl)quinolin-2-yl]oxyhexanoic acid (PubChem CID 10407251) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2,2-dimethyl-6-[4-(4-methylphenyl)quinolin-2-yl]oxyhexanoic acid.
| Compound Name | 2,2-dimethyl-6-[4-(4-methylphenyl)quinolin-2-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 10407251 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2,2-dimethyl-6-[4-(4-methylphenyl)quinolin-2-yl]oxyhexanoic acid |
| SMILES | Cc1ccc(-c2cc(OCCCCC(C)(C)C(=O)O)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-17-10-12-18(13-11-17)20-16-22(25-21-9-5-4-8-19(20)21)28-15-7-6-14-24(2,3)23(26)27/h4-5,8-13,16H,6-7,14-15H2,1-3H3,(H,26,27) |
| InChIKey | PXNIKYNWMFJIBY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|