C21H32O6 — CID 10407414
[(3R,4aR,6R,6aS,7S,10S,10aR,10bS)-3-ethenyl-6,10b-dihydroxy-3,4a,7,10a-tetramethyl-1-oxo-2,5,6,6a,7,8,9,10-octahydrobenzo[f]chromen-10-yl] acetate (PubChem CID 10407414) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(3R,4aR,6R,6aS,7S,10S,10aR,10bS)-3-ethenyl-6,10b-dihydroxy-3,4a,7,10a-tetramethyl-1-oxo-2,5,6,6a,7,8,9,10-octahydrobenzo[f]chromen-10-yl] acetate.
| Compound Name | [(3R,4aR,6R,6aS,7S,10S,10aR,10bS)-3-ethenyl-6,10b-dihydroxy-3,4a,7,10a-tetramethyl-1-oxo-2,5,6,6a,7,8,9,10-octahydrobenzo[f]chromen-10-yl] acetate |
|---|---|
| PubChem CID | 10407414 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [(3R,4aR,6R,6aS,7S,10S,10aR,10bS)-3-ethenyl-6,10b-dihydroxy-3,4a,7,10a-tetramethyl-1-oxo-2,5,6,6a,7,8,9,10-octahydrobenzo[f]chromen-10-yl] acetate |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@]3(C)[C@@H]([C@H](O)C[C@@]2(C)O1)[C@@H](C)CC[C@@H]3OC(C)=O |
| InChI | InChI=1S/C21H32O6/c1-7-18(4)11-15(24)21(25)19(5,27-18)10-14(23)17-12(2)8-9-16(20(17,21)6)26-13(3)22/h7,12,14,16-17,23,25H,1,8-11H2,2-6H3/t12-,14+,16-,17+,18-,19+,20-,21+/m0/s1 |
| InChIKey | YPYKVSHYYIHGNH-HASSCPDXSA-N |
| XLogP | 2.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|