C26H40N2 — CID 10407437
(1R,2S,10Z,16R,23Z,27S)-5,18-diazapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-10,14,23-triene (PubChem CID 10407437) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is (1R,2S,10Z,16R,23Z,27S)-5,18-diazapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-10,14,23-triene.
| Compound Name | (1R,2S,10Z,16R,23Z,27S)-5,18-diazapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-10,14,23-triene |
|---|---|
| PubChem CID | 10407437 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | (1R,2S,10Z,16R,23Z,27S)-5,18-diazapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-10,14,23-triene |
| SMILES | C1=C2CC/C=C\CCCCN3CC[C@H]4[C@@H]1CN1CCCC/C=C\CC[C@@]4(C3)[C@H]21 |
| InChI | InChI=1S/C26H40N2/c1-3-7-11-16-27-18-14-24-23-19-22(13-9-5-1)25-26(24,21-27)15-10-6-2-4-8-12-17-28(25)20-23/h1-2,5-6,19,23-25H,3-4,7-18,20-21H2/b5-1-,6-2-/t23-,24-,25-,26-/m0/s1 |
| InChIKey | WWQLAWPZBZACNJ-CCNZYGDDSA-N |
| XLogP | 5.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|