C17H12BrN3O3 — CID 10407775
6-bromo-10,11-dioxo-N-phenyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-2-carboxamide (PubChem CID 10407775) has the molecular formula C17H12BrN3O3 and a molecular weight of 386.21 g/mol. Its IUPAC name is 6-bromo-10,11-dioxo-N-phenyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-2-carboxamide.
| Compound Name | 6-bromo-10,11-dioxo-N-phenyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-2-carboxamide |
|---|---|
| PubChem CID | 10407775 |
| Molecular Formula | C17H12BrN3O3 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 6-bromo-10,11-dioxo-N-phenyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1Cc2cc(Br)cc3[nH]c(=O)c(=O)n1c23 |
| InChI | InChI=1S/C17H12BrN3O3/c18-10-6-9-7-13(15(22)19-11-4-2-1-3-5-11)21-14(9)12(8-10)20-16(23)17(21)24/h1-6,8,13H,7H2,(H,19,22)(H,20,23) |
| InChIKey | RIGJBTNFORAXLC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|