C18H21N5O3S — CID 10407895
(2R,3R,4S,5S)-2-[6-(benzylamino)purin-9-yl]-5-(methylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 10407895) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[6-(benzylamino)purin-9-yl]-5-(methylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[6-(benzylamino)purin-9-yl]-5-(methylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10407895 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (2R,3R,4S,5S)-2-[6-(benzylamino)purin-9-yl]-5-(methylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | CSC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21N5O3S/c1-27-8-12-14(24)15(25)18(26-12)23-10-22-13-16(20-9-21-17(13)23)19-7-11-5-3-2-4-6-11/h2-6,9-10,12,14-15,18,24-25H,7-8H2,1H3,(H,19,20,21)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | NPIWPIICDHOOPX-SCFUHWHPSA-N |
| XLogP | 1.42 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |