About benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate
benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate (PubChem CID 10408423) has the molecular formula C18H14F2O6S
and a molecular weight of 396.37 g/mol. Its IUPAC name is benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate |
| PubChem CID | 10408423 |
| Molecular Formula | C18H14F2O6S |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate |
| SMILES | O=C1CCC(C(=O)OCc2ccccc2)(S(=O)(=O)c2ccc(F)cc2F)O1 |
| InChI | InChI=1S/C18H14F2O6S/c19-13-6-7-15(14(20)10-13)27(23,24)18(9-8-16(21)26-18)17(22)25-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2 |
| InChIKey | UWNQHLVROJTUSO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate?
The IUPAC name of benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate (CID 10408423) is benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate.
What is the SMILES notation for benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate?
The canonical SMILES for benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate is O=C1CCC(C(=O)OCc2ccccc2)(S(=O)(=O)c2ccc(F)cc2F)O1.
What is the InChIKey of benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate?
The InChIKey is UWNQHLVROJTUSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2O6S/c19-13-6-7-15(14(20)10-13)27(23,24)18(9-8-16(21)26-18)17(22)25-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2.
What are the key properties of benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate?
benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate has a molecular weight of 396.37 g/mol, XLogP of 2.52, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(2,4-difluorophenyl)sulfonyl-5-oxooxolane-2-carboxylate is sourced from PubChem (CID 10408423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).