C21H38O5Si — CID 10408594
(4R,4aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalene-4a-carbaldehyde (PubChem CID 10408594) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is (4R,4aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalene-4a-carbaldehyde.
| Compound Name | (4R,4aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalene-4a-carbaldehyde |
|---|---|
| PubChem CID | 10408594 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (4R,4aR)-7-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)-2,3,4,7,8,8a-hexahydro-1H-naphthalene-4a-carbaldehyde |
| SMILES | COCCOCO[C@@H]1CCCC2CC(O[Si](C)(C)C(C)(C)C)C=C[C@]21C=O |
| InChI | InChI=1S/C21H38O5Si/c1-20(2,3)27(5,6)26-18-10-11-21(15-22)17(14-18)8-7-9-19(21)25-16-24-13-12-23-4/h10-11,15,17-19H,7-9,12-14,16H2,1-6H3/t17?,18?,19-,21+/m1/s1 |
| InChIKey | MKCAJYPJKOYYMD-BRAJZSMUSA-N |
| XLogP | 4.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|