C22H32Cl2O2 — CID 10408620
trans-(3S,4S)-2,2-dichloro-4-methyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]cyclobutan-1-one (PubChem CID 10408620) has the molecular formula C22H32Cl2O2 and a molecular weight of 399.40 g/mol. Its IUPAC name is trans-(3S,4S)-2,2-dichloro-4-methyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]cyclobutan-1-one.
| Compound Name | trans-(3S,4S)-2,2-dichloro-4-methyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]cyclobutan-1-one |
|---|---|
| PubChem CID | 10408620 |
| Molecular Formula | C22H32Cl2O2 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | trans-(3S,4S)-2,2-dichloro-4-methyl-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]cyclobutan-1-one |
| SMILES | CC(C)c1cc(C(C)C)c([C@H](C)O[C@H]2[C@H](C)C(=O)C2(Cl)Cl)c(C(C)C)c1 |
| InChI | InChI=1S/C22H32Cl2O2/c1-11(2)16-9-17(12(3)4)19(18(10-16)13(5)6)15(8)26-21-14(7)20(25)22(21,23)24/h9-15,21H,1-8H3/t14-,15+,21+/m1/s1 |
| InChIKey | KJFRPHMKJRIOQQ-WIEQDCTASA-N |
| XLogP | 6.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|