About N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide
N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide (PubChem CID 1040864) has the molecular formula C16H13ClF3NO3
and a molecular weight of 359.73 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide |
| PubChem CID | 1040864 |
| Molecular Formula | C16H13ClF3NO3 |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc1OC |
| InChI | InChI=1S/C16H13ClF3NO3/c1-23-13-6-3-9(7-14(13)24-2)15(22)21-12-8-10(16(18,19)20)4-5-11(12)17/h3-8H,1-2H3,(H,21,22) |
| InChIKey | FZPGFIWUOANXJP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide?
The IUPAC name of N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide (CID 1040864) is N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide.
What is the SMILES notation for N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide?
The canonical SMILES for N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide is COc1ccc(C(=O)Nc2cc(C(F)(F)F)ccc2Cl)cc1OC.
What is the InChIKey of N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide?
The InChIKey is FZPGFIWUOANXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF3NO3/c1-23-13-6-3-9(7-14(13)24-2)15(22)21-12-8-10(16(18,19)20)4-5-11(12)17/h3-8H,1-2H3,(H,21,22).
What are the key properties of N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide?
N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide has a molecular weight of 359.73 g/mol, XLogP of 4.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-chloro-5-(trifluoromethyl)phenyl]-3,4-dimethoxybenzamide is sourced from PubChem (CID 1040864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).