C22H40O6 — CID 10408709
(3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-14-propyl-oxacyclotetradecane-2,10-dione (PubChem CID 10408709) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-14-propyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-14-propyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 10408709 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-14-propyl-oxacyclotetradecane-2,10-dione |
| SMILES | CCC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C22H40O6/c1-8-9-17-13(4)20(25)14(5)18(23)11(2)10-12(3)19(24)15(6)21(26)16(7)22(27)28-17/h11-17,19-21,24-26H,8-10H2,1-7H3/t11-,12+,13+,14+,15-,16-,17-,19+,20+,21+/m1/s1 |
| InChIKey | CAFPEYWNLASVHQ-JKNGSDSYSA-N |
| XLogP | 2.57 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |