C25H38O4 — CID 10408827
cis-(1R,2R)-2-[5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-(3-hydroxypropyl)-4-methoxyphenyl]cyclopentan-1-ol (PubChem CID 10408827) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is cis-(1R,2R)-2-[5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-(3-hydroxypropyl)-4-methoxyphenyl]cyclopentan-1-ol.
| Compound Name | cis-(1R,2R)-2-[5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-(3-hydroxypropyl)-4-methoxyphenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 10408827 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | cis-(1R,2R)-2-[5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-(3-hydroxypropyl)-4-methoxyphenyl]cyclopentan-1-ol |
| SMILES | COc1cc(CCCO)c([C@H]2CCC[C@H]2O)cc1OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H38O4/c1-18(2)8-5-9-19(3)13-15-29-25-17-22(21-11-6-12-23(21)27)20(10-7-14-26)16-24(25)28-4/h8,13,16-17,21,23,26-27H,5-7,9-12,14-15H2,1-4H3/b19-13+/t21-,23-/m1/s1 |
| InChIKey | NPEDQWRTBJMJLE-YHFNZSLZSA-N |
| XLogP | 5.32 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|