C21H42O5Si — CID 10408833
(E,4S,6S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-4,10,10-trimethoxy-3,9-dimethyldec-2-enal (PubChem CID 10408833) has the molecular formula C21H42O5Si and a molecular weight of 402.65 g/mol. Its IUPAC name is (E,4S,6S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-4,10,10-trimethoxy-3,9-dimethyldec-2-enal.
| Compound Name | (E,4S,6S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-4,10,10-trimethoxy-3,9-dimethyldec-2-enal |
|---|---|
| PubChem CID | 10408833 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (E,4S,6S,9R)-6-[tert-butyl(dimethyl)silyl]oxy-4,10,10-trimethoxy-3,9-dimethyldec-2-enal |
| SMILES | COC(OC)[C@H](C)CC[C@@H](C[C@H](OC)/C(C)=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O5Si/c1-16(13-14-22)19(23-6)15-18(26-27(9,10)21(3,4)5)12-11-17(2)20(24-7)25-8/h13-14,17-20H,11-12,15H2,1-10H3/b16-13+/t17-,18+,19+/m1/s1 |
| InChIKey | GRQKGRPBLZKPFB-BBFGAQQPSA-N |
| XLogP | 4.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|