About S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate
S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate (PubChem CID 10408868) has the molecular formula C23H17NO4S
and a molecular weight of 403.46 g/mol. Its IUPAC name is S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate.
Molecular Properties
| Compound Name | S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate |
| PubChem CID | 10408868 |
| Molecular Formula | C23H17NO4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate |
| SMILES | O=C(Sc1ccccc1)[C@@H]([C@@H](O)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H17NO4S/c25-20(15-9-3-1-4-10-15)19(23(28)29-16-11-5-2-6-12-16)24-21(26)17-13-7-8-14-18(17)22(24)27/h1-14,19-20,25H/t19-,20+/m1/s1 |
| InChIKey | FJGPYWUPBNATBN-UXHICEINSA-N |
| XLogP | 3.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate?
The IUPAC name of S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate (CID 10408868) is S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate.
What is the SMILES notation for S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate?
The canonical SMILES for S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate is O=C(Sc1ccccc1)[C@@H]([C@@H](O)c1ccccc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate?
The InChIKey is FJGPYWUPBNATBN-UXHICEINSA-N. The full InChI is InChI=1S/C23H17NO4S/c25-20(15-9-3-1-4-10-15)19(23(28)29-16-11-5-2-6-12-16)24-21(26)17-13-7-8-14-18(17)22(24)27/h1-14,19-20,25H/t19-,20+/m1/s1.
What are the key properties of S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate?
S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate has a molecular weight of 403.46 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl (2R,3S)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxy-3-phenylpropanethioate is sourced from PubChem (CID 10408868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).