C11H6F14 — CID 10408905
3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)deca-1,9-diene (PubChem CID 10408905) has the molecular formula C11H6F14 and a molecular weight of 404.14 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)deca-1,9-diene.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)deca-1,9-diene |
|---|---|
| PubChem CID | 10408905 |
| Molecular Formula | C11H6F14 |
| Molecular Weight | 404.14 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8-undecafluoro-8-(trifluoromethyl)deca-1,9-diene |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C=C)C(F)(F)F |
| InChI | InChI=1S/C11H6F14/c1-3-5(12,11(23,24)25)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)4-2/h3-4H,1-2H2 |
| InChIKey | CEZPNHJWNHQNEJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.14 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|