C20H18F6O2 — CID 10408912
(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyloxane (PubChem CID 10408912) has the molecular formula C20H18F6O2 and a molecular weight of 404.35 g/mol. Its IUPAC name is (2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyloxane.
| Compound Name | (2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyloxane |
|---|---|
| PubChem CID | 10408912 |
| Molecular Formula | C20H18F6O2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyloxane |
| SMILES | FC(F)(F)c1cc(CO[C@H]2CCCO[C@H]2c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F6O2/c21-19(22,23)15-9-13(10-16(11-15)20(24,25)26)12-28-17-7-4-8-27-18(17)14-5-2-1-3-6-14/h1-3,5-6,9-11,17-18H,4,7-8,12H2/t17-,18-/m0/s1 |
| InChIKey | KVHVYHNXKNBRLU-ROUUACIJSA-N |
| XLogP | 6.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |