C22H19N3O5 — CID 10408991
(5R,6S)-3-(4-carbamimidoyldibenzofuran-2-yl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 10408991) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is (5R,6S)-3-(4-carbamimidoyldibenzofuran-2-yl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-3-(4-carbamimidoyldibenzofuran-2-yl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10408991 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (5R,6S)-3-(4-carbamimidoyldibenzofuran-2-yl)-6-[(1R)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1cc(C2=C(C(=O)O)N3C(=O)[C@H]([C@@H](C)O)[C@H]3C2)cc2c1oc1ccccc12 |
| InChI | InChI=1S/C22H19N3O5/c1-9(26)17-15-8-12(18(22(28)29)25(15)21(17)27)10-6-13-11-4-2-3-5-16(11)30-19(13)14(7-10)20(23)24/h2-7,9,15,17,26H,8H2,1H3,(H3,23,24)(H,28,29)/t9-,15-,17-/m1/s1 |
| InChIKey | BPYZIPMNBWTDMA-SWXJFYGISA-N |
| XLogP | 2.28 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|