C23H24N2O3S — CID 10409189
6-[2-(3-butoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 10409189) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 6-[2-(3-butoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-(3-butoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10409189 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 6-[2-(3-butoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCCCOc1cc(-c2nc(-c3ccc4c(c3)CCC(=O)N4)cs2)ccc1OC |
| InChI | InChI=1S/C23H24N2O3S/c1-3-4-11-28-21-13-17(6-9-20(21)27-2)23-25-19(14-29-23)16-5-8-18-15(12-16)7-10-22(26)24-18/h5-6,8-9,12-14H,3-4,7,10-11H2,1-2H3,(H,24,26) |
| InChIKey | CEAQMBDWWQORDQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|