About 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide
4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 10409351) has the molecular formula C19H17N5O4S
and a molecular weight of 411.44 g/mol. Its IUPAC name is 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide |
| PubChem CID | 10409351 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | CN1C(=O)COc2ccc(-c3ccnc(Nc4ccc(S(N)(=O)=O)cc4)n3)cc21 |
| InChI | InChI=1S/C19H17N5O4S/c1-24-16-10-12(2-7-17(16)28-11-18(24)25)15-8-9-21-19(23-15)22-13-3-5-14(6-4-13)29(20,26)27/h2-10H,11H2,1H3,(H2,20,26,27)(H,21,22,23) |
| InChIKey | MONKLGUZQZAVIK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide?
The IUPAC name of 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide (CID 10409351) is 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide.
What is the SMILES notation for 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide?
The canonical SMILES for 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide is CN1C(=O)COc2ccc(-c3ccnc(Nc4ccc(S(N)(=O)=O)cc4)n3)cc21.
What is the InChIKey of 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide?
The InChIKey is MONKLGUZQZAVIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O4S/c1-24-16-10-12(2-7-17(16)28-11-18(24)25)15-8-9-21-19(23-15)22-13-3-5-14(6-4-13)29(20,26)27/h2-10H,11H2,1H3,(H2,20,26,27)(H,21,22,23).
What are the key properties of 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide?
4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide has a molecular weight of 411.44 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]benzenesulfonamide is sourced from PubChem (CID 10409351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).