C22H21F3N4O — CID 10409530
2-(2-methyl-3-pyridinyl)-2-[4-[(E)-4,4,4-trifluoro-3-phenylbut-2-enoyl]piperazin-1-yl]acetonitrile (PubChem CID 10409530) has the molecular formula C22H21F3N4O and a molecular weight of 414.43 g/mol. Its IUPAC name is 2-(2-methyl-3-pyridinyl)-2-[4-[(E)-4,4,4-trifluoro-3-phenylbut-2-enoyl]piperazin-1-yl]acetonitrile.
| Compound Name | 2-(2-methyl-3-pyridinyl)-2-[4-[(E)-4,4,4-trifluoro-3-phenylbut-2-enoyl]piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 10409530 |
| Molecular Formula | C22H21F3N4O |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-(2-methyl-3-pyridinyl)-2-[4-[(E)-4,4,4-trifluoro-3-phenylbut-2-enoyl]piperazin-1-yl]acetonitrile |
| SMILES | Cc1ncccc1C(C#N)N1CCN(C(=O)/C=C(\c2ccccc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H21F3N4O/c1-16-18(8-5-9-27-16)20(15-26)28-10-12-29(13-11-28)21(30)14-19(22(23,24)25)17-6-3-2-4-7-17/h2-9,14,20H,10-13H2,1H3/b19-14+ |
| InChIKey | PPFAKNGGYYLOBM-XMHGGMMESA-N |
| XLogP | 3.74 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|