About 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide
2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide (PubChem CID 10409583) has the molecular formula C22H20Cl2N2O2
and a molecular weight of 415.32 g/mol. Its IUPAC name is 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide.
Molecular Properties
| Compound Name | 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide |
| PubChem CID | 10409583 |
| Molecular Formula | C22H20Cl2N2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2C(=O)NCCOc2ccccc2)c1Cl |
| InChI | InChI=1S/C22H20Cl2N2O2/c1-15-11-12-18(23)21(20(15)24)26-19-10-6-5-9-17(19)22(27)25-13-14-28-16-7-3-2-4-8-16/h2-12,26H,13-14H2,1H3,(H,25,27) |
| InChIKey | CBUNQTSLJBKXPU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide?
The IUPAC name of 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide (CID 10409583) is 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide.
What is the SMILES notation for 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide?
The canonical SMILES for 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide is Cc1ccc(Cl)c(Nc2ccccc2C(=O)NCCOc2ccccc2)c1Cl.
What is the InChIKey of 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide?
The InChIKey is CBUNQTSLJBKXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20Cl2N2O2/c1-15-11-12-18(23)21(20(15)24)26-19-10-6-5-9-17(19)22(27)25-13-14-28-16-7-3-2-4-8-16/h2-12,26H,13-14H2,1H3,(H,25,27).
What are the key properties of 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide?
2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide has a molecular weight of 415.32 g/mol, XLogP of 5.85, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichloro-3-methylanilino)-N-(2-phenoxyethyl)benzamide is sourced from PubChem (CID 10409583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).