C21H44O4Si2 — CID 10409693
triethyl-[(1S,2S,5R,6R,7S)-6-(methoxymethoxy)-2,5,7-trimethyl-3-trimethylsilyloxycyclohept-3-en-1-yl]oxysilane (PubChem CID 10409693) has the molecular formula C21H44O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is triethyl-[(1S,2S,5R,6R,7S)-6-(methoxymethoxy)-2,5,7-trimethyl-3-trimethylsilyloxycyclohept-3-en-1-yl]oxysilane.
| Compound Name | triethyl-[(1S,2S,5R,6R,7S)-6-(methoxymethoxy)-2,5,7-trimethyl-3-trimethylsilyloxycyclohept-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 10409693 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | triethyl-[(1S,2S,5R,6R,7S)-6-(methoxymethoxy)-2,5,7-trimethyl-3-trimethylsilyloxycyclohept-3-en-1-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@H](OCOC)[C@H](C)C=C(O[Si](C)(C)C)[C@H]1C |
| InChI | InChI=1S/C21H44O4Si2/c1-11-27(12-2,13-3)25-21-17(5)19(24-26(8,9)10)14-16(4)20(18(21)6)23-15-22-7/h14,16-18,20-21H,11-13,15H2,1-10H3/t16-,17-,18+,20-,21-/m1/s1 |
| InChIKey | QVSGMGNARKFNEJ-BBPUYGCGSA-N |
| XLogP | 6.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|