C27H26N4O — CID 10410007
2-[4-(3,3-diphenylprop-2-enoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile (PubChem CID 10410007) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[4-(3,3-diphenylprop-2-enoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile.
| Compound Name | 2-[4-(3,3-diphenylprop-2-enoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile |
|---|---|
| PubChem CID | 10410007 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-[4-(3,3-diphenylprop-2-enoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile |
| SMILES | Cc1ncccc1C(C#N)N1CCN(C(=O)C=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H26N4O/c1-21-24(13-8-14-29-21)26(20-28)30-15-17-31(18-16-30)27(32)19-25(22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-14,19,26H,15-18H2,1H3 |
| InChIKey | BLKLQXLDCZQRPL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|