C24H29N3O2S — CID 10410067
(2E)-3-benzyl-2-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 10410067) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is (2E)-3-benzyl-2-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-3-benzyl-2-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10410067 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (2E)-3-benzyl-2-[(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)C1=CC(=N/N=C2/SCC(=O)N2Cc2ccccc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C24H29N3O2S/c1-23(2,3)18-12-17(13-19(21(18)29)24(4,5)6)25-26-22-27(20(28)15-30-22)14-16-10-8-7-9-11-16/h7-13H,14-15H2,1-6H3/b26-22+ |
| InChIKey | FRICAPCCHVNYHY-XTCLZLMSSA-N |
| XLogP | 5.00 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|