C21H20ClF2NO4 — CID 10410073
(4S)-4-benzyl-3-[(2R,3R)-4-chloro-3-(2,4-difluorophenyl)-3-hydroxy-2-methylbutanoyl]-1,3-oxazolidin-2-one (PubChem CID 10410073) has the molecular formula C21H20ClF2NO4 and a molecular weight of 423.84 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2R,3R)-4-chloro-3-(2,4-difluorophenyl)-3-hydroxy-2-methylbutanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2R,3R)-4-chloro-3-(2,4-difluorophenyl)-3-hydroxy-2-methylbutanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10410073 |
| Molecular Formula | C21H20ClF2NO4 |
| Molecular Weight | 423.84 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (4S)-4-benzyl-3-[(2R,3R)-4-chloro-3-(2,4-difluorophenyl)-3-hydroxy-2-methylbutanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@](O)(CCl)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H20ClF2NO4/c1-13(21(28,12-22)17-8-7-15(23)10-18(17)24)19(26)25-16(11-29-20(25)27)9-14-5-3-2-4-6-14/h2-8,10,13,16,28H,9,11-12H2,1H3/t13-,16-,21+/m0/s1 |
| InChIKey | VWEREKJCRSAXPE-UYTHQXMGSA-N |
| XLogP | 3.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|