C25H22N4O3 — CID 10410195
(3Z,6Z)-3-(pyridin-2-ylmethylidene)-6-[[4-(3-pyridin-3-ylpropoxy)phenyl]methylidene]piperazine-2,5-dione (PubChem CID 10410195) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is (3Z,6Z)-3-(pyridin-2-ylmethylidene)-6-[[4-(3-pyridin-3-ylpropoxy)phenyl]methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3-(pyridin-2-ylmethylidene)-6-[[4-(3-pyridin-3-ylpropoxy)phenyl]methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10410195 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (3Z,6Z)-3-(pyridin-2-ylmethylidene)-6-[[4-(3-pyridin-3-ylpropoxy)phenyl]methylidene]piperazine-2,5-dione |
| SMILES | O=c1[nH]/c(=C\c2ccccn2)c(=O)[nH]/c1=C\c1ccc(OCCCc2cccnc2)cc1 |
| InChI | InChI=1S/C25H22N4O3/c30-24-22(28-25(31)23(29-24)16-20-7-1-2-13-27-20)15-18-8-10-21(11-9-18)32-14-4-6-19-5-3-12-26-17-19/h1-3,5,7-13,15-17H,4,6,14H2,(H,28,31)(H,29,30)/b22-15-,23-16- |
| InChIKey | BJERXUSOIKLRIV-OZKZUFLSSA-N |
| XLogP | 1.52 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|