C25H34N2O4 — CID 10410215
5-[2-(3,4-dimethoxyphenyl)ethylamino]-2-(4-hydroxy-3-methoxyphenyl)-2-propan-2-ylpentanenitrile (PubChem CID 10410215) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)ethylamino]-2-(4-hydroxy-3-methoxyphenyl)-2-propan-2-ylpentanenitrile.
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)ethylamino]-2-(4-hydroxy-3-methoxyphenyl)-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 10410215 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)ethylamino]-2-(4-hydroxy-3-methoxyphenyl)-2-propan-2-ylpentanenitrile |
| SMILES | COc1cc(C(C#N)(CCCNCCc2ccc(OC)c(OC)c2)C(C)C)ccc1O |
| InChI | InChI=1S/C25H34N2O4/c1-18(2)25(17-26,20-8-9-21(28)23(16-20)30-4)12-6-13-27-14-11-19-7-10-22(29-3)24(15-19)31-5/h7-10,15-16,18,27-28H,6,11-14H2,1-5H3 |
| InChIKey | QNBHQNSKRZAZJQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|