C19H17BrN4O3 — CID 10410353
1-[(7-bromo-2,3-dioxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-12-yl)methyl]-3-phenylurea (PubChem CID 10410353) has the molecular formula C19H17BrN4O3 and a molecular weight of 429.27 g/mol. Its IUPAC name is 1-[(7-bromo-2,3-dioxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-12-yl)methyl]-3-phenylurea.
| Compound Name | 1-[(7-bromo-2,3-dioxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-12-yl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 10410353 |
| Molecular Formula | C19H17BrN4O3 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-[(7-bromo-2,3-dioxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-12-yl)methyl]-3-phenylurea |
| SMILES | O=C(NCC1CCc2cc(Br)cc3[nH]c(=O)c(=O)n1c23)Nc1ccccc1 |
| InChI | InChI=1S/C19H17BrN4O3/c20-12-8-11-6-7-14(10-21-19(27)22-13-4-2-1-3-5-13)24-16(11)15(9-12)23-17(25)18(24)26/h1-5,8-9,14H,6-7,10H2,(H,23,25)(H2,21,22,27) |
| InChIKey | JJTHSCWJHQONTF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|