C23H24ClFN2O3 — CID 10410466
methyl 5-chloro-2-[(E)-3-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]benzoate (PubChem CID 10410466) has the molecular formula C23H24ClFN2O3 and a molecular weight of 430.91 g/mol. Its IUPAC name is methyl 5-chloro-2-[(E)-3-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 5-chloro-2-[(E)-3-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 10410466 |
| Molecular Formula | C23H24ClFN2O3 |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | methyl 5-chloro-2-[(E)-3-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1/C=C/C(=O)N1CCN(Cc2ccc(F)cc2)CC1C |
| InChI | InChI=1S/C23H24ClFN2O3/c1-16-14-26(15-17-3-8-20(25)9-4-17)11-12-27(16)22(28)10-6-18-5-7-19(24)13-21(18)23(29)30-2/h3-10,13,16H,11-12,14-15H2,1-2H3/b10-6+ |
| InChIKey | QTNLSMSKXZFKML-UXBLZVDNSA-N |
| XLogP | 4.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|