C22H25NO8 — CID 10410482
[(5R,5aS,6S,9aS,9bS)-9b-hydroxy-6-(hydroxymethyl)-6,9a-dimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] 4-nitrobenzoate (PubChem CID 10410482) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is [(5R,5aS,6S,9aS,9bS)-9b-hydroxy-6-(hydroxymethyl)-6,9a-dimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] 4-nitrobenzoate.
| Compound Name | [(5R,5aS,6S,9aS,9bS)-9b-hydroxy-6-(hydroxymethyl)-6,9a-dimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 10410482 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | [(5R,5aS,6S,9aS,9bS)-9b-hydroxy-6-(hydroxymethyl)-6,9a-dimethyl-3-oxo-1,5,5a,7,8,9-hexahydrobenzo[e][2]benzofuran-5-yl] 4-nitrobenzoate |
| SMILES | C[C@]1(CO)CCC[C@@]2(C)[C@H]1[C@H](OC(=O)c1ccc([N+](=O)[O-])cc1)C=C1C(=O)OC[C@@]12O |
| InChI | InChI=1S/C22H25NO8/c1-20(11-24)8-3-9-21(2)17(20)16(10-15-19(26)30-12-22(15,21)27)31-18(25)13-4-6-14(7-5-13)23(28)29/h4-7,10,16-17,24,27H,3,8-9,11-12H2,1-2H3/t16-,17+,20-,21+,22-/m1/s1 |
| InChIKey | ISKLVGANHNNXLD-PNBTUHDLSA-N |
| XLogP | 2.15 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|