C25H21NO6 — CID 10410483
(16R,20R)-25-methoxy-13,21,21-trimethyl-17,19,22-trioxa-13-azahexacyclo[12.11.0.03,12.05,10.015,23.016,20]pentacosa-1(25),3,5,7,9,11,14,23-octaene-2,18-dione (PubChem CID 10410483) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is (16R,20R)-25-methoxy-13,21,21-trimethyl-17,19,22-trioxa-13-azahexacyclo[12.11.0.03,12.05,10.015,23.016,20]pentacosa-1(25),3,5,7,9,11,14,23-octaene-2,18-dione.
| Compound Name | (16R,20R)-25-methoxy-13,21,21-trimethyl-17,19,22-trioxa-13-azahexacyclo[12.11.0.03,12.05,10.015,23.016,20]pentacosa-1(25),3,5,7,9,11,14,23-octaene-2,18-dione |
|---|---|
| PubChem CID | 10410483 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (16R,20R)-25-methoxy-13,21,21-trimethyl-17,19,22-trioxa-13-azahexacyclo[12.11.0.03,12.05,10.015,23.016,20]pentacosa-1(25),3,5,7,9,11,14,23-octaene-2,18-dione |
| SMILES | COc1cc2c(c3c1c(=O)c1cc4ccccc4cc1n3C)[C@H]1OC(=O)O[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C25H21NO6/c1-25(2)23-22(30-24(28)31-23)19-17(32-25)11-16(29-4)18-20(19)26(3)15-10-13-8-6-5-7-12(13)9-14(15)21(18)27/h5-11,22-23H,1-4H3/t22-,23-/m1/s1 |
| InChIKey | IGTJOTFXMOQZNL-DHIUTWEWSA-N |
| XLogP | 4.60 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|