C24H37NO4Si — CID 10410509
3-[(1R,3S)-3-(furan-3-yl)-4,4-dimethyl-1-trimethylsilyloxypentyl]-2-(pyrrolidine-1-carbonyl)cyclopent-2-en-1-one (PubChem CID 10410509) has the molecular formula C24H37NO4Si and a molecular weight of 431.65 g/mol. Its IUPAC name is 3-[(1R,3S)-3-(furan-3-yl)-4,4-dimethyl-1-trimethylsilyloxypentyl]-2-(pyrrolidine-1-carbonyl)cyclopent-2-en-1-one.
| Compound Name | 3-[(1R,3S)-3-(furan-3-yl)-4,4-dimethyl-1-trimethylsilyloxypentyl]-2-(pyrrolidine-1-carbonyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10410509 |
| Molecular Formula | C24H37NO4Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 3-[(1R,3S)-3-(furan-3-yl)-4,4-dimethyl-1-trimethylsilyloxypentyl]-2-(pyrrolidine-1-carbonyl)cyclopent-2-en-1-one |
| SMILES | CC(C)(C)[C@H](C[C@@H](O[Si](C)(C)C)C1=C(C(=O)N2CCCC2)C(=O)CC1)c1ccoc1 |
| InChI | InChI=1S/C24H37NO4Si/c1-24(2,3)19(17-11-14-28-16-17)15-21(29-30(4,5)6)18-9-10-20(26)22(18)23(27)25-12-7-8-13-25/h11,14,16,19,21H,7-10,12-13,15H2,1-6H3/t19-,21-/m1/s1 |
| InChIKey | LSENHHZVHWYGKO-TZIWHRDSSA-N |
| XLogP | 5.30 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|