C29H53NO — CID 10410513
(4E,8Z,12E)-15-(3,3-dimethyloxiran-2-yl)-N,4,8,13-tetramethyl-N-(4-methylpentyl)pentadeca-4,8,12-trien-1-amine (PubChem CID 10410513) has the molecular formula C29H53NO and a molecular weight of 431.75 g/mol. Its IUPAC name is (4E,8Z,12E)-15-(3,3-dimethyloxiran-2-yl)-N,4,8,13-tetramethyl-N-(4-methylpentyl)pentadeca-4,8,12-trien-1-amine.
| Compound Name | (4E,8Z,12E)-15-(3,3-dimethyloxiran-2-yl)-N,4,8,13-tetramethyl-N-(4-methylpentyl)pentadeca-4,8,12-trien-1-amine |
|---|---|
| PubChem CID | 10410513 |
| Molecular Formula | C29H53NO |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.41 |
| IUPAC Name | (4E,8Z,12E)-15-(3,3-dimethyloxiran-2-yl)-N,4,8,13-tetramethyl-N-(4-methylpentyl)pentadeca-4,8,12-trien-1-amine |
| SMILES | C/C(=C/CC/C=C(\C)CCC1OC1(C)C)CC/C=C(\C)CCCN(C)CCCC(C)C |
| InChI | InChI=1S/C29H53NO/c1-24(2)14-12-22-30(8)23-13-19-26(4)18-11-17-25(3)15-9-10-16-27(5)20-21-28-29(6,7)31-28/h15-16,18,24,28H,9-14,17,19-23H2,1-8H3/b25-15-,26-18+,27-16+ |
| InChIKey | FCKNSAXICMTRDU-FRFWHVEDSA-N |
| XLogP | 8.49 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|