C26H32N4O2 — CID 10410574
3-[4-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]butyl]-1H-indole-5-carboxamide (PubChem CID 10410574) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-[4-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]butyl]-1H-indole-5-carboxamide.
| Compound Name | 3-[4-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]butyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 10410574 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 3-[4-[4-(3,4-dihydro-2H-chromen-6-yl)piperazin-1-yl]butyl]-1H-indole-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]cc(CCCCN3CCN(c4ccc5c(c4)CCCO5)CC3)c2c1 |
| InChI | InChI=1S/C26H32N4O2/c27-26(31)20-6-8-24-23(17-20)21(18-28-24)4-1-2-10-29-11-13-30(14-12-29)22-7-9-25-19(16-22)5-3-15-32-25/h6-9,16-18,28H,1-5,10-15H2,(H2,27,31) |
| InChIKey | ZOTMPHLOFULIPB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|