C27H44O4 — CID 10410583
2-[(3R,5S)-5-(2,4-dimethyl-12-phenyldodecyl)-3,5-dimethyldioxolan-3-yl]acetic acid (PubChem CID 10410583) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2-[(3R,5S)-5-(2,4-dimethyl-12-phenyldodecyl)-3,5-dimethyldioxolan-3-yl]acetic acid.
| Compound Name | 2-[(3R,5S)-5-(2,4-dimethyl-12-phenyldodecyl)-3,5-dimethyldioxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 10410583 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 2-[(3R,5S)-5-(2,4-dimethyl-12-phenyldodecyl)-3,5-dimethyldioxolan-3-yl]acetic acid |
| SMILES | CC(CCCCCCCCc1ccccc1)CC(C)C[C@@]1(C)C[C@](C)(CC(=O)O)OO1 |
| InChI | InChI=1S/C27H44O4/c1-22(14-10-7-5-6-8-11-15-24-16-12-9-13-17-24)18-23(2)19-26(3)21-27(4,31-30-26)20-25(28)29/h9,12-13,16-17,22-23H,5-8,10-11,14-15,18-21H2,1-4H3,(H,28,29)/t22?,23?,26-,27-/m0/s1 |
| InChIKey | BXUWJKHPMWARGU-LYHBZKKCSA-N |
| XLogP | 7.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|