C24H24ClN5O — CID 10410643
N-(6-tert-butyl-3-pyridinyl)-7-(3-chloro-2-pyridinyl)-2-(methoxymethyl)quinazolin-4-amine (PubChem CID 10410643) has the molecular formula C24H24ClN5O and a molecular weight of 433.94 g/mol. Its IUPAC name is N-(6-tert-butyl-3-pyridinyl)-7-(3-chloro-2-pyridinyl)-2-(methoxymethyl)quinazolin-4-amine.
| Compound Name | N-(6-tert-butyl-3-pyridinyl)-7-(3-chloro-2-pyridinyl)-2-(methoxymethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 10410643 |
| Molecular Formula | C24H24ClN5O |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-(6-tert-butyl-3-pyridinyl)-7-(3-chloro-2-pyridinyl)-2-(methoxymethyl)quinazolin-4-amine |
| SMILES | COCc1nc(Nc2ccc(C(C)(C)C)nc2)c2ccc(-c3ncccc3Cl)cc2n1 |
| InChI | InChI=1S/C24H24ClN5O/c1-24(2,3)20-10-8-16(13-27-20)28-23-17-9-7-15(22-18(25)6-5-11-26-22)12-19(17)29-21(30-23)14-31-4/h5-13H,14H2,1-4H3,(H,28,29,30) |
| InChIKey | ZZCAAWJRZYKZTH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |