C11Cl7F3 — CID 10410797
1,2,3,4,5,6,8-heptachloro-7-(trifluoromethyl)naphthalene (PubChem CID 10410797) has the molecular formula C11Cl7F3 and a molecular weight of 437.29 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptachloro-7-(trifluoromethyl)naphthalene.
| Compound Name | 1,2,3,4,5,6,8-heptachloro-7-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 10410797 |
| Molecular Formula | C11Cl7F3 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 433.78 |
| IUPAC Name | 1,2,3,4,5,6,8-heptachloro-7-(trifluoromethyl)naphthalene |
| SMILES | FC(F)(F)c1c(Cl)c(Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2c1Cl |
| InChI | InChI=1S/C11Cl7F3/c12-4-1-2(7(15)10(18)9(17)6(1)14)5(13)8(16)3(4)11(19,20)21 |
| InChIKey | KSQWOWJBDJHZNH-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|