C29H34N4 — CID 10410901
N-[2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]ethyl]-4-pyridin-2-ylbutan-1-amine (PubChem CID 10410901) has the molecular formula C29H34N4 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-[2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]ethyl]-4-pyridin-2-ylbutan-1-amine.
| Compound Name | N-[2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]ethyl]-4-pyridin-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 10410901 |
| Molecular Formula | C29H34N4 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | N-[2-[2-(3,3-diphenylpropyl)-1H-imidazol-5-yl]ethyl]-4-pyridin-2-ylbutan-1-amine |
| SMILES | c1ccc(C(CCc2ncc(CCNCCCCc3ccccn3)[nH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N4/c1-3-11-24(12-4-1)28(25-13-5-2-6-14-25)17-18-29-32-23-27(33-29)19-22-30-20-9-7-15-26-16-8-10-21-31-26/h1-6,8,10-14,16,21,23,28,30H,7,9,15,17-20,22H2,(H,32,33) |
| InChIKey | XPTQCQILQOIXEE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|